C12H20N2O2 — CID 167267080
3-(methylamino)-4-(5-methylhexylamino)cyclobut-3-ene-1,2-dione (PubChem CID 167267080) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-(methylamino)-4-(5-methylhexylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(methylamino)-4-(5-methylhexylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 167267080 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 3-(methylamino)-4-(5-methylhexylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CNc1c(NCCCCC(C)C)c(=O)c1=O |
| InChI | InChI=1S/C12H20N2O2/c1-8(2)6-4-5-7-14-10-9(13-3)11(15)12(10)16/h8,13-14H,4-7H2,1-3H3 |
| InChIKey | DARIFPFCJYWLBN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|