C8H12N2O2 — CID 122595769
3-(methylamino)-4-(propylamino)cyclobut-3-ene-1,2-dione (PubChem CID 122595769) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 3-(methylamino)-4-(propylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(methylamino)-4-(propylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 122595769 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 3-(methylamino)-4-(propylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CCCNc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C8H12N2O2/c1-3-4-10-6-5(9-2)7(11)8(6)12/h9-10H,3-4H2,1-2H3 |
| InChIKey | PVDAHPNSQVKLQM-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|