C14H26N4O2 — CID 107816326
6-amino-1-methyl-5-(7-methyloctylamino)pyrimidine-2,4-dione (PubChem CID 107816326) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 6-amino-1-methyl-5-(7-methyloctylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-methyl-5-(7-methyloctylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 107816326 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 6-amino-1-methyl-5-(7-methyloctylamino)pyrimidine-2,4-dione |
| SMILES | CC(C)CCCCCCNc1c(N)n(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H26N4O2/c1-10(2)8-6-4-5-7-9-16-11-12(15)18(3)14(20)17-13(11)19/h10,16H,4-9,15H2,1-3H3,(H,17,19,20) |
| InChIKey | LNEOWXPNFHXMQY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|