C15H28N4O3 — CID 58969865
N-methyl-N-[2-[[2-(4-(113C)methyl-(5,6-13C2,1,4-15N2)1,4-diazinan-1-yl)acetyl]amino]ethyl]-4-oxo(1,4-13C2)pentanamide (PubChem CID 58969865) has the molecular formula C15H28N4O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is N-methyl-N-[2-[[2-(4-(113C)methyl-(5,6-13C2,1,4-15N2)1,4-diazinan-1-yl)acetyl]amino]ethyl]-4-oxo(1,4-13C2)pentanamide.
| Compound Name | N-methyl-N-[2-[[2-(4-(113C)methyl-(5,6-13C2,1,4-15N2)1,4-diazinan-1-yl)acetyl]amino]ethyl]-4-oxo(1,4-13C2)pentanamide |
|---|---|
| PubChem CID | 58969865 |
| Molecular Formula | C15H28N4O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | N-methyl-N-[2-[[2-(4-(113C)methyl-(5,6-13C2,1,4-15N2)1,4-diazinan-1-yl)acetyl]amino]ethyl]-4-oxo(1,4-13C2)pentanamide |
| SMILES | C[13C](=O)CC[13C](=O)N(C)CCNC(=O)[13CH2][15N]1CC[15N]([13CH3])[13CH2][13CH2]1 |
| InChI | InChI=1S/C15H28N4O3/c1-13(20)4-5-15(22)18(3)7-6-16-14(21)12-19-10-8-17(2)9-11-19/h4-12H2,1-3H3,(H,16,21)/i2+1,8+1,10+1,12+1,13+1,15+1,17+1,19+1 |
| InChIKey | AOOSJVGXAIMVDT-LJLXMKCMSA-N |
| XLogP | -0.82 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |