C16H26N2O6 — CID 154946310
(2S)-2-[[(1S)-1-carboxy-4-cyclobutyl-4-oxobutyl]carbamoylamino]-4-methylpentanoic acid (PubChem CID 154946310) has the molecular formula C16H26N2O6 and a molecular weight of 342.39 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-4-cyclobutyl-4-oxobutyl]carbamoylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-4-cyclobutyl-4-oxobutyl]carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 154946310 |
| Molecular Formula | C16H26N2O6 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-4-cyclobutyl-4-oxobutyl]carbamoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)N[C@@H](CCC(=O)C1CCC1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H26N2O6/c1-9(2)8-12(15(22)23)18-16(24)17-11(14(20)21)6-7-13(19)10-4-3-5-10/h9-12H,3-8H2,1-2H3,(H,20,21)(H,22,23)(H2,17,18,24)/t11-,12-/m0/s1 |
| InChIKey | CKFAOVYOJJCIJJ-RYUDHWBXSA-N |
| XLogP | 1.39 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |