C18H22ClFN2O — CID 119429870
2-fluoro-N-[3-(methylamino)propyl]-4-(4-methylphenyl)benzamide;hydrochloride (PubChem CID 119429870) has the molecular formula C18H22ClFN2O and a molecular weight of 336.84 g/mol. Its IUPAC name is 2-fluoro-N-[3-(methylamino)propyl]-4-(4-methylphenyl)benzamide;hydrochloride.
| Compound Name | 2-fluoro-N-[3-(methylamino)propyl]-4-(4-methylphenyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119429870 |
| Molecular Formula | C18H22ClFN2O |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-fluoro-N-[3-(methylamino)propyl]-4-(4-methylphenyl)benzamide;hydrochloride |
| SMILES | CNCCCNC(=O)c1ccc(-c2ccc(C)cc2)cc1F.Cl |
| InChI | InChI=1S/C18H21FN2O.ClH/c1-13-4-6-14(7-5-13)15-8-9-16(17(19)12-15)18(22)21-11-3-10-20-2;/h4-9,12,20H,3,10-11H2,1-2H3,(H,21,22);1H |
| InChIKey | QQWUCJKTZPVOCF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|