C15H19F2NO4 — CID 119350764
7-[(3,6-difluoro-2-methoxybenzoyl)amino]heptanoic acid (PubChem CID 119350764) has the molecular formula C15H19F2NO4 and a molecular weight of 315.32 g/mol. Its IUPAC name is 7-[(3,6-difluoro-2-methoxybenzoyl)amino]heptanoic acid.
| Compound Name | 7-[(3,6-difluoro-2-methoxybenzoyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 119350764 |
| Molecular Formula | C15H19F2NO4 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 7-[(3,6-difluoro-2-methoxybenzoyl)amino]heptanoic acid |
| SMILES | COc1c(F)ccc(F)c1C(=O)NCCCCCCC(=O)O |
| InChI | InChI=1S/C15H19F2NO4/c1-22-14-11(17)8-7-10(16)13(14)15(21)18-9-5-3-2-4-6-12(19)20/h7-8H,2-6,9H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | WCCZCIGKVHCWQQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|