C14H17BrFNO3 — CID 166277024
6-[(3-bromo-6-fluoro-2-methylbenzoyl)amino]hexanoic acid (PubChem CID 166277024) has the molecular formula C14H17BrFNO3 and a molecular weight of 346.20 g/mol. Its IUPAC name is 6-[(3-bromo-6-fluoro-2-methylbenzoyl)amino]hexanoic acid.
| Compound Name | 6-[(3-bromo-6-fluoro-2-methylbenzoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 166277024 |
| Molecular Formula | C14H17BrFNO3 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 6-[(3-bromo-6-fluoro-2-methylbenzoyl)amino]hexanoic acid |
| SMILES | Cc1c(Br)ccc(F)c1C(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C14H17BrFNO3/c1-9-10(15)6-7-11(16)13(9)14(20)17-8-4-2-3-5-12(18)19/h6-7H,2-5,8H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | RJTLNPGDGCYVKW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|