C11H11BrFN5O — CID 154783159
3-bromo-6-fluoro-2-methyl-N-[2-(tetrazol-1-yl)ethyl]benzamide (PubChem CID 154783159) has the molecular formula C11H11BrFN5O and a molecular weight of 328.15 g/mol. Its IUPAC name is 3-bromo-6-fluoro-2-methyl-N-[2-(tetrazol-1-yl)ethyl]benzamide.
| Compound Name | 3-bromo-6-fluoro-2-methyl-N-[2-(tetrazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 154783159 |
| Molecular Formula | C11H11BrFN5O |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 3-bromo-6-fluoro-2-methyl-N-[2-(tetrazol-1-yl)ethyl]benzamide |
| SMILES | Cc1c(Br)ccc(F)c1C(=O)NCCn1cnnn1 |
| InChI | InChI=1S/C11H11BrFN5O/c1-7-8(12)2-3-9(13)10(7)11(19)14-4-5-18-6-15-16-17-18/h2-3,6H,4-5H2,1H3,(H,14,19) |
| InChIKey | RPTHIXWLXLMEKX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |