C15H19BrFNO3 — CID 120524041
7-[[2-(4-bromo-3-fluorophenyl)acetyl]amino]heptanoic acid (PubChem CID 120524041) has the molecular formula C15H19BrFNO3 and a molecular weight of 360.22 g/mol. Its IUPAC name is 7-[[2-(4-bromo-3-fluorophenyl)acetyl]amino]heptanoic acid.
| Compound Name | 7-[[2-(4-bromo-3-fluorophenyl)acetyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 120524041 |
| Molecular Formula | C15H19BrFNO3 |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 7-[[2-(4-bromo-3-fluorophenyl)acetyl]amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)Cc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C15H19BrFNO3/c16-12-7-6-11(9-13(12)17)10-14(19)18-8-4-2-1-3-5-15(20)21/h6-7,9H,1-5,8,10H2,(H,18,19)(H,20,21) |
| InChIKey | KKKOPVRRTGVMTA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|