C13H15F2NO4 — CID 119346965
4-[(3,6-difluoro-2-methoxybenzoyl)-methylamino]butanoic acid (PubChem CID 119346965) has the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. Its IUPAC name is 4-[(3,6-difluoro-2-methoxybenzoyl)-methylamino]butanoic acid.
| Compound Name | 4-[(3,6-difluoro-2-methoxybenzoyl)-methylamino]butanoic acid |
|---|---|
| PubChem CID | 119346965 |
| Molecular Formula | C13H15F2NO4 |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-[(3,6-difluoro-2-methoxybenzoyl)-methylamino]butanoic acid |
| SMILES | COc1c(F)ccc(F)c1C(=O)N(C)CCCC(=O)O |
| InChI | InChI=1S/C13H15F2NO4/c1-16(7-3-4-10(17)18)13(19)11-8(14)5-6-9(15)12(11)20-2/h5-6H,3-4,7H2,1-2H3,(H,17,18) |
| InChIKey | UNIHAXJCCQHPLC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |