C11H13FINO3 — CID 103857248
4-fluoro-N,N-bis(2-hydroxyethyl)-2-iodobenzamide (PubChem CID 103857248) has the molecular formula C11H13FINO3 and a molecular weight of 353.13 g/mol. Its IUPAC name is 4-fluoro-N,N-bis(2-hydroxyethyl)-2-iodobenzamide.
| Compound Name | 4-fluoro-N,N-bis(2-hydroxyethyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 103857248 |
| Molecular Formula | C11H13FINO3 |
| Molecular Weight | 353.13 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 4-fluoro-N,N-bis(2-hydroxyethyl)-2-iodobenzamide |
| SMILES | O=C(c1ccc(F)cc1I)N(CCO)CCO |
| InChI | InChI=1S/C11H13FINO3/c12-8-1-2-9(10(13)7-8)11(17)14(3-5-15)4-6-16/h1-2,7,15-16H,3-6H2 |
| InChIKey | AMEZHSRUXGNPAE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.13 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|