C13H18N2O3 — CID 103865091
N-(2-amino-2-oxoethyl)-4-hydroxy-2-methyl-N-propan-2-ylbenzamide (PubChem CID 103865091) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-hydroxy-2-methyl-N-propan-2-ylbenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-hydroxy-2-methyl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 103865091 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-hydroxy-2-methyl-N-propan-2-ylbenzamide |
| SMILES | Cc1cc(O)ccc1C(=O)N(CC(N)=O)C(C)C |
| InChI | InChI=1S/C13H18N2O3/c1-8(2)15(7-12(14)17)13(18)11-5-4-10(16)6-9(11)3/h4-6,8,16H,7H2,1-3H3,(H2,14,17) |
| InChIKey | CNEYUQJZNLSOBR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |