C18H26ClN3O5S — CID 36861151
ethyl 4-[2-chloro-5-[methyl(propan-2-yl)sulfamoyl]benzoyl]piperazine-1-carboxylate (PubChem CID 36861151) has the molecular formula C18H26ClN3O5S and a molecular weight of 431.94 g/mol. Its IUPAC name is ethyl 4-[2-chloro-5-[methyl(propan-2-yl)sulfamoyl]benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-chloro-5-[methyl(propan-2-yl)sulfamoyl]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 36861151 |
| Molecular Formula | C18H26ClN3O5S |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | ethyl 4-[2-chloro-5-[methyl(propan-2-yl)sulfamoyl]benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cc(S(=O)(=O)N(C)C(C)C)ccc2Cl)CC1 |
| InChI | InChI=1S/C18H26ClN3O5S/c1-5-27-18(24)22-10-8-21(9-11-22)17(23)15-12-14(6-7-16(15)19)28(25,26)20(4)13(2)3/h6-7,12-13H,5,8-11H2,1-4H3 |
| InChIKey | BUIKLPCOCYFITO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |