C12H14BrCl2NO2 — CID 114242843
N-[2-(2-bromoethoxy)ethyl]-2,4-dichloro-N-methylbenzamide (PubChem CID 114242843) has the molecular formula C12H14BrCl2NO2 and a molecular weight of 355.06 g/mol. Its IUPAC name is N-[2-(2-bromoethoxy)ethyl]-2,4-dichloro-N-methylbenzamide.
| Compound Name | N-[2-(2-bromoethoxy)ethyl]-2,4-dichloro-N-methylbenzamide |
|---|---|
| PubChem CID | 114242843 |
| Molecular Formula | C12H14BrCl2NO2 |
| Molecular Weight | 355.06 g/mol |
| Exact Mass | 352.96 |
| IUPAC Name | N-[2-(2-bromoethoxy)ethyl]-2,4-dichloro-N-methylbenzamide |
| SMILES | CN(CCOCCBr)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14BrCl2NO2/c1-16(5-7-18-6-4-13)12(17)10-3-2-9(14)8-11(10)15/h2-3,8H,4-7H2,1H3 |
| InChIKey | UAWGYJNNNTWQNR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.06 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|