C15H22BrNOS — CID 107022149
4-bromo-N,N-dibutyl-2-sulfanylbenzamide (PubChem CID 107022149) has the molecular formula C15H22BrNOS and a molecular weight of 344.32 g/mol. Its IUPAC name is 4-bromo-N,N-dibutyl-2-sulfanylbenzamide.
| Compound Name | 4-bromo-N,N-dibutyl-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 107022149 |
| Molecular Formula | C15H22BrNOS |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 4-bromo-N,N-dibutyl-2-sulfanylbenzamide |
| SMILES | CCCCN(CCCC)C(=O)c1ccc(Br)cc1S |
| InChI | InChI=1S/C15H22BrNOS/c1-3-5-9-17(10-6-4-2)15(18)13-8-7-12(16)11-14(13)19/h7-8,11,19H,3-6,9-10H2,1-2H3 |
| InChIKey | AHOBAESKIJJIMV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|