C15H24BrNOS — CID 63525816
5-bromo-N,N-bis(3-methylbutyl)thiophene-3-carboxamide (PubChem CID 63525816) has the molecular formula C15H24BrNOS and a molecular weight of 346.33 g/mol. Its IUPAC name is 5-bromo-N,N-bis(3-methylbutyl)thiophene-3-carboxamide.
| Compound Name | 5-bromo-N,N-bis(3-methylbutyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 63525816 |
| Molecular Formula | C15H24BrNOS |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 5-bromo-N,N-bis(3-methylbutyl)thiophene-3-carboxamide |
| SMILES | CC(C)CCN(CCC(C)C)C(=O)c1csc(Br)c1 |
| InChI | InChI=1S/C15H24BrNOS/c1-11(2)5-7-17(8-6-12(3)4)15(18)13-9-14(16)19-10-13/h9-12H,5-8H2,1-4H3 |
| InChIKey | IWSMKLAKMLRJPK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |