C11H14BrNOS — CID 43424494
5-bromo-N-ethyl-N-(2-methylprop-2-enyl)thiophene-3-carboxamide (PubChem CID 43424494) has the molecular formula C11H14BrNOS and a molecular weight of 288.21 g/mol. Its IUPAC name is 5-bromo-N-ethyl-N-(2-methylprop-2-enyl)thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-ethyl-N-(2-methylprop-2-enyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 43424494 |
| Molecular Formula | C11H14BrNOS |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 5-bromo-N-ethyl-N-(2-methylprop-2-enyl)thiophene-3-carboxamide |
| SMILES | C=C(C)CN(CC)C(=O)c1csc(Br)c1 |
| InChI | InChI=1S/C11H14BrNOS/c1-4-13(6-8(2)3)11(14)9-5-10(12)15-7-9/h5,7H,2,4,6H2,1,3H3 |
| InChIKey | DVAGFLDPSYOUCF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|