C10H13BrN2OS2 — CID 107961729
N-(3-amino-3-sulfanylidenepropyl)-5-bromo-N-ethylthiophene-3-carboxamide (PubChem CID 107961729) has the molecular formula C10H13BrN2OS2 and a molecular weight of 321.27 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-5-bromo-N-ethylthiophene-3-carboxamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-5-bromo-N-ethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 107961729 |
| Molecular Formula | C10H13BrN2OS2 |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-5-bromo-N-ethylthiophene-3-carboxamide |
| SMILES | CCN(CCC(N)=S)C(=O)c1csc(Br)c1 |
| InChI | InChI=1S/C10H13BrN2OS2/c1-2-13(4-3-9(12)15)10(14)7-5-8(11)16-6-7/h5-6H,2-4H2,1H3,(H2,12,15) |
| InChIKey | DZOVRPLWJQYINL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|