C11H15BrN2O2S2 — CID 107961794
N-(3-amino-3-sulfanylidenepropyl)-5-bromo-N-(2-methoxyethyl)thiophene-3-carboxamide (PubChem CID 107961794) has the molecular formula C11H15BrN2O2S2 and a molecular weight of 351.29 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-5-bromo-N-(2-methoxyethyl)thiophene-3-carboxamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-5-bromo-N-(2-methoxyethyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107961794 |
| Molecular Formula | C11H15BrN2O2S2 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-5-bromo-N-(2-methoxyethyl)thiophene-3-carboxamide |
| SMILES | COCCN(CCC(N)=S)C(=O)c1csc(Br)c1 |
| InChI | InChI=1S/C11H15BrN2O2S2/c1-16-5-4-14(3-2-10(13)17)11(15)8-6-9(12)18-7-8/h6-7H,2-5H2,1H3,(H2,13,17) |
| InChIKey | AEGSBXMHCDLZSI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|