C12H16FN3O2S — CID 104785884
N-(3-amino-3-sulfanylidenepropyl)-5-fluoro-N-(2-methoxyethyl)pyridine-3-carboxamide (PubChem CID 104785884) has the molecular formula C12H16FN3O2S and a molecular weight of 285.34 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-5-fluoro-N-(2-methoxyethyl)pyridine-3-carboxamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-5-fluoro-N-(2-methoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 104785884 |
| Molecular Formula | C12H16FN3O2S |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-5-fluoro-N-(2-methoxyethyl)pyridine-3-carboxamide |
| SMILES | COCCN(CCC(N)=S)C(=O)c1cncc(F)c1 |
| InChI | InChI=1S/C12H16FN3O2S/c1-18-5-4-16(3-2-11(14)19)12(17)9-6-10(13)8-15-7-9/h6-8H,2-5H2,1H3,(H2,14,19) |
| InChIKey | BUIOOYOOZYYWPQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|