C13H17IN2O2S — CID 63287439
N-(3-amino-3-sulfanylidenepropyl)-4-iodo-N-(2-methoxyethyl)benzamide (PubChem CID 63287439) has the molecular formula C13H17IN2O2S and a molecular weight of 392.26 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-4-iodo-N-(2-methoxyethyl)benzamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-4-iodo-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 63287439 |
| Molecular Formula | C13H17IN2O2S |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-4-iodo-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(CCC(N)=S)C(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C13H17IN2O2S/c1-18-9-8-16(7-6-12(15)19)13(17)10-2-4-11(14)5-3-10/h2-5H,6-9H2,1H3,(H2,15,19) |
| InChIKey | ZEBSUMUJYOXNNI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|