C13H16Cl2N2O2S — CID 63287704
N-(3-amino-3-sulfanylidenepropyl)-3,5-dichloro-N-(2-methoxyethyl)benzamide (PubChem CID 63287704) has the molecular formula C13H16Cl2N2O2S and a molecular weight of 335.26 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-3,5-dichloro-N-(2-methoxyethyl)benzamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-3,5-dichloro-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 63287704 |
| Molecular Formula | C13H16Cl2N2O2S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-3,5-dichloro-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(CCC(N)=S)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N2O2S/c1-19-5-4-17(3-2-12(16)20)13(18)9-6-10(14)8-11(15)7-9/h6-8H,2-5H2,1H3,(H2,16,20) |
| InChIKey | NYTORNIGQIBVCX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|