C16H25BrN2O3 — CID 110612673
5-bromo-N-[2-[2-(diethylamino)ethoxy]ethyl]-2-methoxybenzamide (PubChem CID 110612673) has the molecular formula C16H25BrN2O3 and a molecular weight of 373.29 g/mol. Its IUPAC name is 5-bromo-N-[2-[2-(diethylamino)ethoxy]ethyl]-2-methoxybenzamide.
| Compound Name | 5-bromo-N-[2-[2-(diethylamino)ethoxy]ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 110612673 |
| Molecular Formula | C16H25BrN2O3 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 5-bromo-N-[2-[2-(diethylamino)ethoxy]ethyl]-2-methoxybenzamide |
| SMILES | CCN(CC)CCOCCNC(=O)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C16H25BrN2O3/c1-4-19(5-2)9-11-22-10-8-18-16(20)14-12-13(17)6-7-15(14)21-3/h6-7,12H,4-5,8-11H2,1-3H3,(H,18,20) |
| InChIKey | OJWZIQWUUFMCJN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|