C11H12Br2N2O2 — CID 114370284
2,5-dibromo-N-[2-(ethylamino)-2-oxoethyl]benzamide (PubChem CID 114370284) has the molecular formula C11H12Br2N2O2 and a molecular weight of 364.04 g/mol. Its IUPAC name is 2,5-dibromo-N-[2-(ethylamino)-2-oxoethyl]benzamide.
| Compound Name | 2,5-dibromo-N-[2-(ethylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 114370284 |
| Molecular Formula | C11H12Br2N2O2 |
| Molecular Weight | 364.04 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | 2,5-dibromo-N-[2-(ethylamino)-2-oxoethyl]benzamide |
| SMILES | CCNC(=O)CNC(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H12Br2N2O2/c1-2-14-10(16)6-15-11(17)8-5-7(12)3-4-9(8)13/h3-5H,2,6H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | PJCQCKCNUJGNRS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.04 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |