C10H8Br2ClNO — CID 114372871
2,5-dibromo-N-(2-chloroprop-2-enyl)benzamide (PubChem CID 114372871) has the molecular formula C10H8Br2ClNO and a molecular weight of 353.44 g/mol. Its IUPAC name is 2,5-dibromo-N-(2-chloroprop-2-enyl)benzamide.
| Compound Name | 2,5-dibromo-N-(2-chloroprop-2-enyl)benzamide |
|---|---|
| PubChem CID | 114372871 |
| Molecular Formula | C10H8Br2ClNO |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 350.87 |
| IUPAC Name | 2,5-dibromo-N-(2-chloroprop-2-enyl)benzamide |
| SMILES | C=C(Cl)CNC(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C10H8Br2ClNO/c1-6(13)5-14-10(15)8-4-7(11)2-3-9(8)12/h2-4H,1,5H2,(H,14,15) |
| InChIKey | PVGTURVTKYKJEU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |