C15H14Br2N2O — CID 114374315
N-[[2-(aminomethyl)phenyl]methyl]-2,5-dibromobenzamide (PubChem CID 114374315) has the molecular formula C15H14Br2N2O and a molecular weight of 398.10 g/mol. Its IUPAC name is N-[[2-(aminomethyl)phenyl]methyl]-2,5-dibromobenzamide.
| Compound Name | N-[[2-(aminomethyl)phenyl]methyl]-2,5-dibromobenzamide |
|---|---|
| PubChem CID | 114374315 |
| Molecular Formula | C15H14Br2N2O |
| Molecular Weight | 398.10 g/mol |
| Exact Mass | 395.95 |
| IUPAC Name | N-[[2-(aminomethyl)phenyl]methyl]-2,5-dibromobenzamide |
| SMILES | NCc1ccccc1CNC(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C15H14Br2N2O/c16-12-5-6-14(17)13(7-12)15(20)19-9-11-4-2-1-3-10(11)8-18/h1-7H,8-9,18H2,(H,19,20) |
| InChIKey | XUIIOIKEQVQFGC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.10 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |