C19H17F3N2O2 — CID 69315293
4-[2-[(dimethylamino)methyl]indol-1-yl]-3-(trifluoromethyl)benzoic acid (PubChem CID 69315293) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is 4-[2-[(dimethylamino)methyl]indol-1-yl]-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[2-[(dimethylamino)methyl]indol-1-yl]-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 69315293 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 4-[2-[(dimethylamino)methyl]indol-1-yl]-3-(trifluoromethyl)benzoic acid |
| SMILES | CN(C)Cc1cc2ccccc2n1-c1ccc(C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C19H17F3N2O2/c1-23(2)11-14-9-12-5-3-4-6-16(12)24(14)17-8-7-13(18(25)26)10-15(17)19(20,21)22/h3-10H,11H2,1-2H3,(H,25,26) |
| InChIKey | GLQFHTAHIMBIEC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |