About CID 176652156
CID 176652156 (PubChem CID 176652156) has the molecular formula C10H12BF3NO2
and a molecular weight of 246.02 g/mol.
Molecular Properties
| Compound Name | CID 176652156 |
| PubChem CID | 176652156 |
| Molecular Formula | C10H12BF3NO2 |
| Molecular Weight | 246.02 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | — |
| SMILES | CN(C)Cc1ccc(O[B]O)cc1C(F)(F)F |
| InChI | InChI=1S/C10H12BF3NO2/c1-15(2)6-7-3-4-8(17-11-16)5-9(7)10(12,13)14/h3-5,16H,6H2,1-2H3 |
| InChIKey | MWVQPBSSTJBKFV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.02 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 176652156 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176652156?
The IUPAC name of CID 176652156 (CID 176652156) is not available.
What is the SMILES notation for CID 176652156?
The canonical SMILES for CID 176652156 is CN(C)Cc1ccc(O[B]O)cc1C(F)(F)F.
What is the InChIKey of CID 176652156?
The InChIKey is MWVQPBSSTJBKFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BF3NO2/c1-15(2)6-7-3-4-8(17-11-16)5-9(7)10(12,13)14/h3-5,16H,6H2,1-2H3.
What are the key properties of CID 176652156?
CID 176652156 has a molecular weight of 246.02 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176652156 is sourced from PubChem (CID 176652156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).