C14H14BrClN2O — CID 110787166
N-[(5-bromo-2-methylphenyl)methyl]pyridine-4-carboxamide;hydrochloride (PubChem CID 110787166) has the molecular formula C14H14BrClN2O and a molecular weight of 341.64 g/mol. Its IUPAC name is N-[(5-bromo-2-methylphenyl)methyl]pyridine-4-carboxamide;hydrochloride.
| Compound Name | N-[(5-bromo-2-methylphenyl)methyl]pyridine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 110787166 |
| Molecular Formula | C14H14BrClN2O |
| Molecular Weight | 341.64 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | N-[(5-bromo-2-methylphenyl)methyl]pyridine-4-carboxamide;hydrochloride |
| SMILES | Cc1ccc(Br)cc1CNC(=O)c1ccncc1.Cl |
| InChI | InChI=1S/C14H13BrN2O.ClH/c1-10-2-3-13(15)8-12(10)9-17-14(18)11-4-6-16-7-5-11;/h2-8H,9H2,1H3,(H,17,18);1H |
| InChIKey | RILNUEMJFPTTOZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |