C13H18BrNO3 — CID 115122702
5-[(5-bromo-2-methylphenyl)methylamino]-4-hydroxypentanoic acid (PubChem CID 115122702) has the molecular formula C13H18BrNO3 and a molecular weight of 316.19 g/mol. Its IUPAC name is 5-[(5-bromo-2-methylphenyl)methylamino]-4-hydroxypentanoic acid.
| Compound Name | 5-[(5-bromo-2-methylphenyl)methylamino]-4-hydroxypentanoic acid |
|---|---|
| PubChem CID | 115122702 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 5-[(5-bromo-2-methylphenyl)methylamino]-4-hydroxypentanoic acid |
| SMILES | Cc1ccc(Br)cc1CNCC(O)CCC(=O)O |
| InChI | InChI=1S/C13H18BrNO3/c1-9-2-3-11(14)6-10(9)7-15-8-12(16)4-5-13(17)18/h2-3,6,12,15-16H,4-5,7-8H2,1H3,(H,17,18) |
| InChIKey | WCDXECMMJJMYEH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |