C13H21BrN2 — CID 115202154
N'-[2-(3-bromophenyl)ethyl]-N-methylbutane-1,4-diamine (PubChem CID 115202154) has the molecular formula C13H21BrN2 and a molecular weight of 285.23 g/mol. Its IUPAC name is N'-[2-(3-bromophenyl)ethyl]-N-methylbutane-1,4-diamine.
| Compound Name | N'-[2-(3-bromophenyl)ethyl]-N-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115202154 |
| Molecular Formula | C13H21BrN2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N'-[2-(3-bromophenyl)ethyl]-N-methylbutane-1,4-diamine |
| SMILES | CNCCCCNCCc1cccc(Br)c1 |
| InChI | InChI=1S/C13H21BrN2/c1-15-8-2-3-9-16-10-7-12-5-4-6-13(14)11-12/h4-6,11,15-16H,2-3,7-10H2,1H3 |
| InChIKey | FJWOGRGOBKLNTC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|