C12H14F2O — CID 102308052
(3R)-4,4-difluoro-1-phenylhex-5-en-3-ol (PubChem CID 102308052) has the molecular formula C12H14F2O and a molecular weight of 212.24 g/mol. Its IUPAC name is (3R)-4,4-difluoro-1-phenylhex-5-en-3-ol.
| Compound Name | (3R)-4,4-difluoro-1-phenylhex-5-en-3-ol |
|---|---|
| PubChem CID | 102308052 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3R)-4,4-difluoro-1-phenylhex-5-en-3-ol |
| SMILES | C=CC(F)(F)[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C12H14F2O/c1-2-12(13,14)11(15)9-8-10-6-4-3-5-7-10/h2-7,11,15H,1,8-9H2/t11-/m1/s1 |
| InChIKey | IMKUPPHOEJEDCM-LLVKDONJSA-N |
| XLogP | 2.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|