C18H26O2 — CID 85416610
3-cyclohexyl-6-phenylhex-1-ene-3,4-diol (PubChem CID 85416610) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 3-cyclohexyl-6-phenylhex-1-ene-3,4-diol.
| Compound Name | 3-cyclohexyl-6-phenylhex-1-ene-3,4-diol |
|---|---|
| PubChem CID | 85416610 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 3-cyclohexyl-6-phenylhex-1-ene-3,4-diol |
| SMILES | C=CC(O)(C(O)CCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H26O2/c1-2-18(20,16-11-7-4-8-12-16)17(19)14-13-15-9-5-3-6-10-15/h2-3,5-6,9-10,16-17,19-20H,1,4,7-8,11-14H2 |
| InChIKey | USVYAIMGKWPHOG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|