About dicyclohexylmethanol;prop-2-enylbenzene
dicyclohexylmethanol;prop-2-enylbenzene (PubChem CID 174723759) has the molecular formula C22H34O
and a molecular weight of 314.51 g/mol. Its IUPAC name is dicyclohexylmethanol;prop-2-enylbenzene.
Molecular Properties
| Compound Name | dicyclohexylmethanol;prop-2-enylbenzene |
| PubChem CID | 174723759 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | dicyclohexylmethanol;prop-2-enylbenzene |
| SMILES | C=CCc1ccccc1.OC(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C13H24O.C9H10/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-6-9-7-4-3-5-8-9/h11-14H,1-10H2;2-5,7-8H,1,6H2 |
| InChIKey | UZVJYMCYLLMTLK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexylmethanol;prop-2-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexylmethanol;prop-2-enylbenzene?
The IUPAC name of dicyclohexylmethanol;prop-2-enylbenzene (CID 174723759) is dicyclohexylmethanol;prop-2-enylbenzene.
What is the SMILES notation for dicyclohexylmethanol;prop-2-enylbenzene?
The canonical SMILES for dicyclohexylmethanol;prop-2-enylbenzene is C=CCc1ccccc1.OC(C1CCCCC1)C1CCCCC1.
What is the InChIKey of dicyclohexylmethanol;prop-2-enylbenzene?
The InChIKey is UZVJYMCYLLMTLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O.C9H10/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-6-9-7-4-3-5-8-9/h11-14H,1-10H2;2-5,7-8H,1,6H2.
What are the key properties of dicyclohexylmethanol;prop-2-enylbenzene?
dicyclohexylmethanol;prop-2-enylbenzene has a molecular weight of 314.51 g/mol, XLogP of 5.92, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexylmethanol;prop-2-enylbenzene is sourced from PubChem (CID 174723759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).