C16H22O — CID 102302622
cyclohexyl-(2-prop-2-enylphenyl)methanol (PubChem CID 102302622) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is cyclohexyl-(2-prop-2-enylphenyl)methanol.
| Compound Name | cyclohexyl-(2-prop-2-enylphenyl)methanol |
|---|---|
| PubChem CID | 102302622 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | cyclohexyl-(2-prop-2-enylphenyl)methanol |
| SMILES | C=CCc1ccccc1C(O)C1CCCCC1 |
| InChI | InChI=1S/C16H22O/c1-2-8-13-9-6-7-12-15(13)16(17)14-10-4-3-5-11-14/h2,6-7,9,12,14,16-17H,1,3-5,8,10-11H2 |
| InChIKey | HZRDUSSCZIYBLZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|