About CID 173414157
CID 173414157 (PubChem CID 173414157) has the molecular formula C20H27FIn
and a molecular weight of 401.25 g/mol.
Molecular Properties
| Compound Name | CID 173414157 |
| PubChem CID | 173414157 |
| Molecular Formula | C20H27FIn |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | — |
| SMILES | CC(CCc1ccccc1)[In]C(C)CCc1ccccc1.F |
| InChI | InChI=1S/2C10H13.FH.In/c2*1-2-3-7-10-8-5-4-6-9-10;;/h2*2,4-6,8-9H,3,7H2,1H3;1H; |
| InChIKey | HJZKXAHVKDECFW-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 173414157 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173414157?
The IUPAC name of CID 173414157 (CID 173414157) is not available.
What is the SMILES notation for CID 173414157?
The canonical SMILES for CID 173414157 is CC(CCc1ccccc1)[In]C(C)CCc1ccccc1.F.
What is the InChIKey of CID 173414157?
The InChIKey is HJZKXAHVKDECFW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H13.FH.In/c2*1-2-3-7-10-8-5-4-6-9-10;;/h2*2,4-6,8-9H,3,7H2,1H3;1H;.
What are the key properties of CID 173414157?
CID 173414157 has a molecular weight of 401.25 g/mol, XLogP of 5.73, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173414157 is sourced from PubChem (CID 173414157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).