C9H9N5 — CID 66725267
N-benzyl-1,2,4,5-tetrazin-3-amine (PubChem CID 66725267) has the molecular formula C9H9N5 and a molecular weight of 187.21 g/mol. Its IUPAC name is N-benzyl-1,2,4,5-tetrazin-3-amine.
| Compound Name | N-benzyl-1,2,4,5-tetrazin-3-amine |
|---|---|
| PubChem CID | 66725267 |
| Molecular Formula | C9H9N5 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | N-benzyl-1,2,4,5-tetrazin-3-amine |
| SMILES | c1ccc(CNc2nncnn2)cc1 |
| InChI | InChI=1S/C9H9N5/c1-2-4-8(5-3-1)6-10-9-13-11-7-12-14-9/h1-5,7H,6H2,(H,10,13,14) |
| InChIKey | IKJTUVOMGWWUPM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |