C10H10ClN5 — CID 130708825
3-N-benzyl-6-chloro-1,2,4-triazine-3,5-diamine (PubChem CID 130708825) has the molecular formula C10H10ClN5 and a molecular weight of 235.68 g/mol. Its IUPAC name is 3-N-benzyl-6-chloro-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-benzyl-6-chloro-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 130708825 |
| Molecular Formula | C10H10ClN5 |
| Molecular Weight | 235.68 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 3-N-benzyl-6-chloro-1,2,4-triazine-3,5-diamine |
| SMILES | Nc1nc(NCc2ccccc2)nnc1Cl |
| InChI | InChI=1S/C10H10ClN5/c11-8-9(12)14-10(16-15-8)13-6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,12,13,14,16) |
| InChIKey | BJUCSAJMAGAXPI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.68 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |