C9H10N6 — CID 170855880
N-[(4-aminophenyl)methyl]-1,2,4,5-tetrazin-3-amine (PubChem CID 170855880) has the molecular formula C9H10N6 and a molecular weight of 202.22 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-1,2,4,5-tetrazin-3-amine.
| Compound Name | N-[(4-aminophenyl)methyl]-1,2,4,5-tetrazin-3-amine |
|---|---|
| PubChem CID | 170855880 |
| Molecular Formula | C9H10N6 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-1,2,4,5-tetrazin-3-amine |
| SMILES | Nc1ccc(CNc2nncnn2)cc1 |
| InChI | InChI=1S/C9H10N6/c10-8-3-1-7(2-4-8)5-11-9-14-12-6-13-15-9/h1-4,6H,5,10H2,(H,11,14,15) |
| InChIKey | IUJZUNUHDGTKIO-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|