C10H11N3O — CID 82669485
N-[(4-aminophenyl)methyl]-1,2-oxazol-3-amine (PubChem CID 82669485) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-1,2-oxazol-3-amine.
| Compound Name | N-[(4-aminophenyl)methyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 82669485 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-1,2-oxazol-3-amine |
| SMILES | Nc1ccc(CNc2ccon2)cc1 |
| InChI | InChI=1S/C10H11N3O/c11-9-3-1-8(2-4-9)7-12-10-5-6-14-13-10/h1-6H,7,11H2,(H,12,13) |
| InChIKey | CPNBWDFEVJAYHC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|