About N-benzyltetrazin-5-amine
N-benzyltetrazin-5-amine (PubChem CID 91284101) has the molecular formula C9H9N5
and a molecular weight of 187.21 g/mol. Its IUPAC name is N-benzyltetrazin-5-amine.
Molecular Properties
| Compound Name | N-benzyltetrazin-5-amine |
| PubChem CID | 91284101 |
| Molecular Formula | C9H9N5 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | N-benzyltetrazin-5-amine |
| SMILES | c1ccc(CNc2cnnnn2)cc1 |
| InChI | InChI=1S/C9H9N5/c1-2-4-8(5-3-1)6-10-9-7-11-13-14-12-9/h1-5,7H,6H2,(H,10,12,13) |
| InChIKey | FIBGJVKRULGAAQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzyltetrazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyltetrazin-5-amine?
The IUPAC name of N-benzyltetrazin-5-amine (CID 91284101) is N-benzyltetrazin-5-amine.
What is the SMILES notation for N-benzyltetrazin-5-amine?
The canonical SMILES for N-benzyltetrazin-5-amine is c1ccc(CNc2cnnnn2)cc1.
What is the InChIKey of N-benzyltetrazin-5-amine?
The InChIKey is FIBGJVKRULGAAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N5/c1-2-4-8(5-3-1)6-10-9-7-11-13-14-12-9/h1-5,7H,6H2,(H,10,12,13).
What are the key properties of N-benzyltetrazin-5-amine?
N-benzyltetrazin-5-amine has a molecular weight of 187.21 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyltetrazin-5-amine is sourced from PubChem (CID 91284101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).