C24H18N6O — CID 16911174
2-N-(4-phenoxyphenyl)-4-N-phenylpteridine-2,4-diamine (PubChem CID 16911174) has the molecular formula C24H18N6O and a molecular weight of 406.45 g/mol. Its IUPAC name is 2-N-(4-phenoxyphenyl)-4-N-phenylpteridine-2,4-diamine.
| Compound Name | 2-N-(4-phenoxyphenyl)-4-N-phenylpteridine-2,4-diamine |
|---|---|
| PubChem CID | 16911174 |
| Molecular Formula | C24H18N6O |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-N-(4-phenoxyphenyl)-4-N-phenylpteridine-2,4-diamine |
| SMILES | c1ccc(Nc2nc(Nc3ccc(Oc4ccccc4)cc3)nc3nccnc23)cc1 |
| InChI | InChI=1S/C24H18N6O/c1-3-7-17(8-4-1)27-23-21-22(26-16-15-25-21)29-24(30-23)28-18-11-13-20(14-12-18)31-19-9-5-2-6-10-19/h1-16H,(H2,26,27,28,29,30) |
| InChIKey | VYFYKVPKFWRZDT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |