C19H16N6 — CID 177147618
2-N-(4-aminophenyl)-4-N-phenylpyrido[2,3-d]pyrimidine-2,4-diamine (PubChem CID 177147618) has the molecular formula C19H16N6 and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-N-(4-aminophenyl)-4-N-phenylpyrido[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-aminophenyl)-4-N-phenylpyrido[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 177147618 |
| Molecular Formula | C19H16N6 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-N-(4-aminophenyl)-4-N-phenylpyrido[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Nc1ccc(Nc2nc(Nc3ccccc3)c3cccnc3n2)cc1 |
| InChI | InChI=1S/C19H16N6/c20-13-8-10-15(11-9-13)23-19-24-17-16(7-4-12-21-17)18(25-19)22-14-5-2-1-3-6-14/h1-12H,20H2,(H2,21,22,23,24,25) |
| InChIKey | BLHNWPTVKDFOHK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|