C34H25ClN6 — CID 88568522
2-N-[4-[9-(4-aminophenyl)fluoren-9-yl]phenyl]-6-chloro-4-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 88568522) has the molecular formula C34H25ClN6 and a molecular weight of 553.07 g/mol. Its IUPAC name is 2-N-[4-[9-(4-aminophenyl)fluoren-9-yl]phenyl]-6-chloro-4-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[4-[9-(4-aminophenyl)fluoren-9-yl]phenyl]-6-chloro-4-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 88568522 |
| Molecular Formula | C34H25ClN6 |
| Molecular Weight | 553.07 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 2-N-[4-[9-(4-aminophenyl)fluoren-9-yl]phenyl]-6-chloro-4-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1ccc(C2(c3ccc(Nc4nc(Cl)nc(Nc5ccccc5)n4)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C34H25ClN6/c35-31-39-32(37-25-8-2-1-3-9-25)41-33(40-31)38-26-20-16-23(17-21-26)34(22-14-18-24(36)19-15-22)29-12-6-4-10-27(29)28-11-5-7-13-30(28)34/h1-21H,36H2,(H2,37,38,39,40,41) |
| InChIKey | LWTQPDGKMVUNGY-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.07 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|