C18H18F6IN5O2 — CID 170392953
N-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-(4-iodoanilino)-1,3,5-triazin-2-yl]hexanamide (PubChem CID 170392953) has the molecular formula C18H18F6IN5O2 and a molecular weight of 577.27 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-(4-iodoanilino)-1,3,5-triazin-2-yl]hexanamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-(4-iodoanilino)-1,3,5-triazin-2-yl]hexanamide |
|---|---|
| PubChem CID | 170392953 |
| Molecular Formula | C18H18F6IN5O2 |
| Molecular Weight | 577.27 g/mol |
| Exact Mass | 577.04 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-(4-iodoanilino)-1,3,5-triazin-2-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1nc(Nc2ccc(I)cc2)nc(OC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C18H18F6IN5O2/c1-2-3-4-5-12(31)27-15-28-14(26-11-8-6-10(25)7-9-11)29-16(30-15)32-13(17(19,20)21)18(22,23)24/h6-9,13H,2-5H2,1H3,(H2,26,27,28,29,30,31) |
| InChIKey | JPAYLODFNKKUFM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.27 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|