C21H36N6O3 — CID 14619504
N-[4,6-bis(hexanoylamino)-1,3,5-triazin-2-yl]hexanamide (PubChem CID 14619504) has the molecular formula C21H36N6O3 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-[4,6-bis(hexanoylamino)-1,3,5-triazin-2-yl]hexanamide.
| Compound Name | N-[4,6-bis(hexanoylamino)-1,3,5-triazin-2-yl]hexanamide |
|---|---|
| PubChem CID | 14619504 |
| Molecular Formula | C21H36N6O3 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | N-[4,6-bis(hexanoylamino)-1,3,5-triazin-2-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1nc(NC(=O)CCCCC)nc(NC(=O)CCCCC)n1 |
| InChI | InChI=1S/C21H36N6O3/c1-4-7-10-13-16(28)22-19-25-20(23-17(29)14-11-8-5-2)27-21(26-19)24-18(30)15-12-9-6-3/h4-15H2,1-3H3,(H3,22,23,24,25,26,27,28,29,30) |
| InChIKey | GSYQATQSYSLKRE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|