C11H17F3N4O — CID 78805803
N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]octanamide (PubChem CID 78805803) has the molecular formula C11H17F3N4O and a molecular weight of 278.28 g/mol. Its IUPAC name is N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]octanamide.
| Compound Name | N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]octanamide |
|---|---|
| PubChem CID | 78805803 |
| Molecular Formula | C11H17F3N4O |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H17F3N4O/c1-2-3-4-5-6-7-8(19)15-10-16-9(17-18-10)11(12,13)14/h2-7H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | HBASCTXNMABPGV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|