C38H41N15O2 — CID 118934221
4-[2-[[4-anilino-6-[2-[2-[[4-anilino-6-[2-(4-hydroxyphenyl)ethylamino]-1,3,5-triazin-2-yl]diazenyl]ethylamino]ethyldiazenyl]-1,3,5-triazin-2-yl]amino]ethyl]phenol (PubChem CID 118934221) has the molecular formula C38H41N15O2 and a molecular weight of 739.85 g/mol. Its IUPAC name is 4-[2-[[4-anilino-6-[2-[2-[[4-anilino-6-[2-(4-hydroxyphenyl)ethylamino]-1,3,5-triazin-2-yl]diazenyl]ethylamino]ethyldiazenyl]-1,3,5-triazin-2-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[4-anilino-6-[2-[2-[[4-anilino-6-[2-(4-hydroxyphenyl)ethylamino]-1,3,5-triazin-2-yl]diazenyl]ethylamino]ethyldiazenyl]-1,3,5-triazin-2-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 118934221 |
| Molecular Formula | C38H41N15O2 |
| Molecular Weight | 739.85 g/mol |
| Exact Mass | 739.36 |
| IUPAC Name | 4-[2-[[4-anilino-6-[2-[2-[[4-anilino-6-[2-(4-hydroxyphenyl)ethylamino]-1,3,5-triazin-2-yl]diazenyl]ethylamino]ethyldiazenyl]-1,3,5-triazin-2-yl]amino]ethyl]phenol |
| SMILES | Oc1ccc(CCNc2nc(/N=N/CCNCC/N=N/c3nc(NCCc4ccc(O)cc4)nc(Nc4ccccc4)n3)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C38H41N15O2/c54-31-15-11-27(12-16-31)19-21-40-33-46-35(44-29-7-3-1-4-8-29)50-37(48-33)52-42-25-23-39-24-26-43-53-38-49-34(41-22-20-28-13-17-32(55)18-14-28)47-36(51-38)45-30-9-5-2-6-10-30/h1-18,39,54-55H,19-26H2,(H2,40,44,46,48,50)(H2,41,45,47,49,51)/b52-42+,53-43+ |
| InChIKey | RNVLTDZYEXLEIS-ULUJXTRKSA-N |
| XLogP | 6.72 |
| TPSA | 227.39 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.85 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|