C22H28FN7 — CID 59330706
6-N-(4-aminobutyl)-2-N-(3-fluorophenyl)-4-N-[2-(4-methylphenyl)ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 59330706) has the molecular formula C22H28FN7 and a molecular weight of 409.51 g/mol. Its IUPAC name is 6-N-(4-aminobutyl)-2-N-(3-fluorophenyl)-4-N-[2-(4-methylphenyl)ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(4-aminobutyl)-2-N-(3-fluorophenyl)-4-N-[2-(4-methylphenyl)ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 59330706 |
| Molecular Formula | C22H28FN7 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 6-N-(4-aminobutyl)-2-N-(3-fluorophenyl)-4-N-[2-(4-methylphenyl)ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1ccc(CCNc2nc(NCCCCN)nc(Nc3cccc(F)c3)n2)cc1 |
| InChI | InChI=1S/C22H28FN7/c1-16-7-9-17(10-8-16)11-14-26-21-28-20(25-13-3-2-12-24)29-22(30-21)27-19-6-4-5-18(23)15-19/h4-10,15H,2-3,11-14,24H2,1H3,(H3,25,26,27,28,29,30) |
| InChIKey | IRLPOGQKXGBOQK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|